C21H33F — CID 142358346
1-ethyl-4-[4-[(3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-yl]cyclohexyl]cyclohexane (PubChem CID 142358346) has the molecular formula C21H33F and a molecular weight of 304.49 g/mol. Its IUPAC name is 1-ethyl-4-[4-[(3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-yl]cyclohexyl]cyclohexane.
| Compound Name | 1-ethyl-4-[4-[(3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-yl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 142358346 |
| Molecular Formula | C21H33F |
| Molecular Weight | 304.49 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 1-ethyl-4-[4-[(3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-yl]cyclohexyl]cyclohexane |
| SMILES | C=C(C)/C=C(/F)C(=C)C1CCC(C2CCC(CC)CC2)CC1 |
| InChI | InChI=1S/C21H33F/c1-5-17-6-8-19(9-7-17)20-12-10-18(11-13-20)16(4)21(22)14-15(2)3/h14,17-20H,2,4-13H2,1,3H3/b21-14+ |
| InChIKey | ACVOJDLIUJUEAJ-KGENOOAVSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.49 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|