About N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine
N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine (PubChem CID 170254294) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine |
| PubChem CID | 170254294 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine |
| SMILES | C=C(C1CCC(CC)CC1)N(C)C(C)(C)C |
| InChI | InChI=1S/C15H29N/c1-7-13-8-10-14(11-9-13)12(2)16(6)15(3,4)5/h13-14H,2,7-11H2,1,3-6H3 |
| InChIKey | UWNBHAVHSKCHKS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine?
The IUPAC name of N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine (CID 170254294) is N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine.
What is the SMILES notation for N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine?
The canonical SMILES for N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine is C=C(C1CCC(CC)CC1)N(C)C(C)(C)C.
What is the InChIKey of N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine?
The InChIKey is UWNBHAVHSKCHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N/c1-7-13-8-10-14(11-9-13)12(2)16(6)15(3,4)5/h13-14H,2,7-11H2,1,3-6H3.
What are the key properties of N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine?
N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine has a molecular weight of 223.40 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-ethylcyclohexyl)ethenyl]-N,2-dimethylpropan-2-amine is sourced from PubChem (CID 170254294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).