C23H38O — CID 145066002
1-ethyl-4-[4-[(3Z)-5-propoxyhexa-1,3,5-trien-2-yl]cyclohexyl]cyclohexane (PubChem CID 145066002) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is 1-ethyl-4-[4-[(3Z)-5-propoxyhexa-1,3,5-trien-2-yl]cyclohexyl]cyclohexane.
| Compound Name | 1-ethyl-4-[4-[(3Z)-5-propoxyhexa-1,3,5-trien-2-yl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 145066002 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | 1-ethyl-4-[4-[(3Z)-5-propoxyhexa-1,3,5-trien-2-yl]cyclohexyl]cyclohexane |
| SMILES | C=C(/C=C\C(=C)C1CCC(C2CCC(CC)CC2)CC1)OCCC |
| InChI | InChI=1S/C23H38O/c1-5-17-24-19(4)8-7-18(3)21-13-15-23(16-14-21)22-11-9-20(6-2)10-12-22/h7-8,20-23H,3-6,9-17H2,1-2H3/b8-7- |
| InChIKey | IUUZGWAGMRLBFD-FPLPWBNLSA-N |
| XLogP | 7.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|