About 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate
1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate (PubChem CID 143266128) has the molecular formula C24H42O2
and a molecular weight of 362.60 g/mol. Its IUPAC name is 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate |
| PubChem CID | 143266128 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate |
| SMILES | CCC1CCCC(C2CCC(C(=O)OC(C)C3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C24H42O2/c1-3-19-8-7-11-21(13-12-19)22-14-16-23(17-15-22)24(25)26-18(2)20-9-5-4-6-10-20/h18-23H,3-17H2,1-2H3 |
| InChIKey | RYFLSSSPYAAMLQ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate?
The IUPAC name of 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate (CID 143266128) is 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate.
What is the SMILES notation for 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate?
The canonical SMILES for 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate is CCC1CCCC(C2CCC(C(=O)OC(C)C3CCCCC3)CC2)CC1.
What is the InChIKey of 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate?
The InChIKey is RYFLSSSPYAAMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O2/c1-3-19-8-7-11-21(13-12-19)22-14-16-23(17-15-22)24(25)26-18(2)20-9-5-4-6-10-20/h18-23H,3-17H2,1-2H3.
What are the key properties of 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate?
1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate has a molecular weight of 362.60 g/mol, XLogP of 6.91, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethyl 4-(4-ethylcycloheptyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 143266128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).