C21H38O2 — CID 70455312
[(2S)-pentan-2-yl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 70455312) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is [(2S)-pentan-2-yl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [(2S)-pentan-2-yl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70455312 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | [(2S)-pentan-2-yl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C2CCC(C(=O)O[C@@H](C)CCC)CC2)CC1 |
| InChI | InChI=1S/C21H38O2/c1-4-6-16(3)23-21(22)20-14-12-19(13-15-20)18-10-8-17(7-5-2)9-11-18/h16-20H,4-15H2,1-3H3/t16-,17?,18?,19?,20?/m0/s1 |
| InChIKey | HDWRRXVBHGAHDP-KUNTWMTDSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |