About ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate
ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 145154741) has the molecular formula C24H46O2
and a molecular weight of 366.63 g/mol. Its IUPAC name is ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
| PubChem CID | 145154741 |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.35 |
| IUPAC Name | ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CC.CCC(C)CCC(C)OC(=O)C1CCC(C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C22H40O2.C2H6/c1-5-16(2)6-9-18(4)24-22(23)21-14-12-20(13-15-21)19-10-7-17(3)8-11-19;1-2/h16-21H,5-15H2,1-4H3;1-2H3 |
| InChIKey | JLWSLCHODZSSMX-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate?
The IUPAC name of ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate (CID 145154741) is ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate.
What is the SMILES notation for ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate?
The canonical SMILES for ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate is CC.CCC(C)CCC(C)OC(=O)C1CCC(C2CCC(C)CC2)CC1.
What is the InChIKey of ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate?
The InChIKey is JLWSLCHODZSSMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40O2.C2H6/c1-5-16(2)6-9-18(4)24-22(23)21-14-12-20(13-15-21)19-10-7-17(3)8-11-19;1-2/h16-21H,5-15H2,1-4H3;1-2H3.
What are the key properties of ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate?
ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate has a molecular weight of 366.63 g/mol, XLogP of 7.40, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylheptan-2-yl 4-(4-methylcyclohexyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 145154741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).