C26H48O2 — CID 18604859
[(2R)-octan-2-yl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 18604859) has the molecular formula C26H48O2 and a molecular weight of 392.67 g/mol. Its IUPAC name is [(2R)-octan-2-yl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [(2R)-octan-2-yl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18604859 |
| Molecular Formula | C26H48O2 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.37 |
| IUPAC Name | [(2R)-octan-2-yl] 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCC[C@@H](C)OC(=O)C1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C26H48O2/c1-4-6-8-10-11-21(3)28-26(27)25-19-17-24(18-20-25)23-15-13-22(14-16-23)12-9-7-5-2/h21-25H,4-20H2,1-3H3/t21-,22?,23?,24?,25?/m1/s1 |
| InChIKey | VISIUYQBIAWXBF-VWWJWQJWSA-N |
| XLogP | 8.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|