C39H70O4 — CID 59307257
2-[[4-(4-pentylcyclohexyl)cyclohexyl]methylperoxy]propyl 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 59307257) has the molecular formula C39H70O4 and a molecular weight of 602.99 g/mol. Its IUPAC name is 2-[[4-(4-pentylcyclohexyl)cyclohexyl]methylperoxy]propyl 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | 2-[[4-(4-pentylcyclohexyl)cyclohexyl]methylperoxy]propyl 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59307257 |
| Molecular Formula | C39H70O4 |
| Molecular Weight | 602.99 g/mol |
| Exact Mass | 602.53 |
| IUPAC Name | 2-[[4-(4-pentylcyclohexyl)cyclohexyl]methylperoxy]propyl 4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C2CCC(COOC(C)COC(=O)C3CCC(C4CCC(CCCCC)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C39H70O4/c1-4-6-8-10-31-12-18-34(19-13-31)36-22-16-33(17-23-36)29-42-43-30(3)28-41-39(40)38-26-24-37(25-27-38)35-20-14-32(15-21-35)11-9-7-5-2/h30-38H,4-29H2,1-3H3 |
| InChIKey | FOVNPGSBONLUMR-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.99 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|