C25H46O2 — CID 54056254
[(2R)-2-methylbutyl] 4-(4-heptylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 54056254) has the molecular formula C25H46O2 and a molecular weight of 378.64 g/mol. Its IUPAC name is [(2R)-2-methylbutyl] 4-(4-heptylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [(2R)-2-methylbutyl] 4-(4-heptylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54056254 |
| Molecular Formula | C25H46O2 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.35 |
| IUPAC Name | [(2R)-2-methylbutyl] 4-(4-heptylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCC1CCC(C2CCC(C(=O)OC[C@H](C)CC)CC2)CC1 |
| InChI | InChI=1S/C25H46O2/c1-4-6-7-8-9-10-21-11-13-22(14-12-21)23-15-17-24(18-16-23)25(26)27-19-20(3)5-2/h20-24H,4-19H2,1-3H3/t20-,21?,22?,23?,24?/m1/s1 |
| InChIKey | LWLWZPBOIOUFHC-AZQVTIPCSA-N |
| XLogP | 7.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|