C21H34O2 — CID 88674306
[(3E)-penta-1,3-dienyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 88674306) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is [(3E)-penta-1,3-dienyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [(3E)-penta-1,3-dienyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88674306 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | [(3E)-penta-1,3-dienyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | C/C=C/C=COC(=O)C1CCC(C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C21H34O2/c1-3-5-6-16-23-21(22)20-14-12-19(13-15-20)18-10-8-17(7-4-2)9-11-18/h3,5-6,16-20H,4,7-15H2,1-2H3/b5-3+,16-6? |
| InChIKey | ZNABNZDPPMYHQU-DVJPBLQZSA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|