C8H11NO — CID 90867738
N-cyclobutylbuta-2,3-dienamide (PubChem CID 90867738) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is N-cyclobutylbuta-2,3-dienamide.
| Compound Name | N-cyclobutylbuta-2,3-dienamide |
|---|---|
| PubChem CID | 90867738 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | N-cyclobutylbuta-2,3-dienamide |
| SMILES | C=C=CC(=O)NC1CCC1 |
| InChI | InChI=1S/C8H11NO/c1-2-4-8(10)9-7-5-3-6-7/h4,7H,1,3,5-6H2,(H,9,10) |
| InChIKey | FOGTZNMNAHSYDY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|