About cyclobutylcarbamothioic S-acid
cyclobutylcarbamothioic S-acid (PubChem CID 115169770) has the molecular formula C5H9NOS
and a molecular weight of 131.20 g/mol. Its IUPAC name is cyclobutylcarbamothioic S-acid.
Molecular Properties
| Compound Name | cyclobutylcarbamothioic S-acid |
| PubChem CID | 115169770 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | cyclobutylcarbamothioic S-acid |
| SMILES | O=C(S)NC1CCC1 |
| InChI | InChI=1S/C5H9NOS/c7-5(8)6-4-2-1-3-4/h4H,1-3H2,(H2,6,7,8) |
| InChIKey | PVGJBVOXGLOCJC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclobutylcarbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylcarbamothioic S-acid?
The IUPAC name of cyclobutylcarbamothioic S-acid (CID 115169770) is cyclobutylcarbamothioic S-acid.
What is the SMILES notation for cyclobutylcarbamothioic S-acid?
The canonical SMILES for cyclobutylcarbamothioic S-acid is O=C(S)NC1CCC1.
What is the InChIKey of cyclobutylcarbamothioic S-acid?
The InChIKey is PVGJBVOXGLOCJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NOS/c7-5(8)6-4-2-1-3-4/h4H,1-3H2,(H2,6,7,8).
What are the key properties of cyclobutylcarbamothioic S-acid?
cyclobutylcarbamothioic S-acid has a molecular weight of 131.20 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylcarbamothioic S-acid is sourced from PubChem (CID 115169770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).