C11H16N2O — CID 103529089
2-cyano-N-hex-1-yn-3-yl-2-methylpropanamide (PubChem CID 103529089) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-cyano-N-hex-1-yn-3-yl-2-methylpropanamide.
| Compound Name | 2-cyano-N-hex-1-yn-3-yl-2-methylpropanamide |
|---|---|
| PubChem CID | 103529089 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-cyano-N-hex-1-yn-3-yl-2-methylpropanamide |
| SMILES | C#CC(CCC)NC(=O)C(C)(C)C#N |
| InChI | InChI=1S/C11H16N2O/c1-5-7-9(6-2)13-10(14)11(3,4)8-12/h2,9H,5,7H2,1,3-4H3,(H,13,14) |
| InChIKey | ROHHTXZQNVGZOD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|