C17H29NO — CID 114161118
4-tert-butyl-N-hex-1-yn-3-ylcyclohexane-1-carboxamide (PubChem CID 114161118) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 4-tert-butyl-N-hex-1-yn-3-ylcyclohexane-1-carboxamide.
| Compound Name | 4-tert-butyl-N-hex-1-yn-3-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114161118 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 4-tert-butyl-N-hex-1-yn-3-ylcyclohexane-1-carboxamide |
| SMILES | C#CC(CCC)NC(=O)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H29NO/c1-6-8-15(7-2)18-16(19)13-9-11-14(12-10-13)17(3,4)5/h2,13-15H,6,8-12H2,1,3-5H3,(H,18,19) |
| InChIKey | AWYDRJDUGQTDME-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|