C16H30BrNO — CID 114316175
N-(1-bromo-3-methylbutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide (PubChem CID 114316175) has the molecular formula C16H30BrNO and a molecular weight of 332.33 g/mol. Its IUPAC name is N-(1-bromo-3-methylbutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide.
| Compound Name | N-(1-bromo-3-methylbutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114316175 |
| Molecular Formula | C16H30BrNO |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-(1-bromo-3-methylbutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide |
| SMILES | CC(C)C(CBr)NC(=O)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30BrNO/c1-11(2)14(10-17)18-15(19)12-6-8-13(9-7-12)16(3,4)5/h11-14H,6-10H2,1-5H3,(H,18,19) |
| InChIKey | APQNQUQUHSOYRW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|