C16H31NO2 — CID 115744551
4-tert-butyl-N-(2-hydroxy-3-methylbutyl)cyclohexane-1-carboxamide (PubChem CID 115744551) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-hydroxy-3-methylbutyl)cyclohexane-1-carboxamide.
| Compound Name | 4-tert-butyl-N-(2-hydroxy-3-methylbutyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 115744551 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 4-tert-butyl-N-(2-hydroxy-3-methylbutyl)cyclohexane-1-carboxamide |
| SMILES | CC(C)C(O)CNC(=O)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H31NO2/c1-11(2)14(18)10-17-15(19)12-6-8-13(9-7-12)16(3,4)5/h11-14,18H,6-10H2,1-5H3,(H,17,19) |
| InChIKey | LZZDSOZUIZBWNB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |