C14H27NO2 — CID 83030657
4-tert-butyl-N-[(2S)-2-hydroxypropyl]cyclohexane-1-carboxamide (PubChem CID 83030657) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2S)-2-hydroxypropyl]cyclohexane-1-carboxamide.
| Compound Name | 4-tert-butyl-N-[(2S)-2-hydroxypropyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 83030657 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 4-tert-butyl-N-[(2S)-2-hydroxypropyl]cyclohexane-1-carboxamide |
| SMILES | C[C@H](O)CNC(=O)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27NO2/c1-10(16)9-15-13(17)11-5-7-12(8-6-11)14(2,3)4/h10-12,16H,5-9H2,1-4H3,(H,15,17)/t10-,11?,12?/m0/s1 |
| InChIKey | CSRSLENOGIKDGT-UNXYVOJBSA-N |
| XLogP | 2.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |