C13H21NO2 — CID 106228527
2-ethyl-N-hex-1-yn-3-yloxolane-3-carboxamide (PubChem CID 106228527) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-ethyl-N-hex-1-yn-3-yloxolane-3-carboxamide.
| Compound Name | 2-ethyl-N-hex-1-yn-3-yloxolane-3-carboxamide |
|---|---|
| PubChem CID | 106228527 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2-ethyl-N-hex-1-yn-3-yloxolane-3-carboxamide |
| SMILES | C#CC(CCC)NC(=O)C1CCOC1CC |
| InChI | InChI=1S/C13H21NO2/c1-4-7-10(5-2)14-13(15)11-8-9-16-12(11)6-3/h2,10-12H,4,6-9H2,1,3H3,(H,14,15) |
| InChIKey | LDTCQPOXOUVSQV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|