C12H20N2O — CID 106230636
N-hex-1-yn-3-yl-3-methylpyrrolidine-2-carboxamide (PubChem CID 106230636) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N-hex-1-yn-3-yl-3-methylpyrrolidine-2-carboxamide.
| Compound Name | N-hex-1-yn-3-yl-3-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 106230636 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-hex-1-yn-3-yl-3-methylpyrrolidine-2-carboxamide |
| SMILES | C#CC(CCC)NC(=O)C1NCCC1C |
| InChI | InChI=1S/C12H20N2O/c1-4-6-10(5-2)14-12(15)11-9(3)7-8-13-11/h2,9-11,13H,4,6-8H2,1,3H3,(H,14,15) |
| InChIKey | RQFVIGRCVZHZPJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|