C15H28N2OS — CID 62718554
N-(1-amino-1-sulfanylidenebutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide (PubChem CID 62718554) has the molecular formula C15H28N2OS and a molecular weight of 284.47 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenebutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide.
| Compound Name | N-(1-amino-1-sulfanylidenebutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 62718554 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-(1-amino-1-sulfanylidenebutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide |
| SMILES | CCC(NC(=O)C1CCC(C(C)(C)C)CC1)C(N)=S |
| InChI | InChI=1S/C15H28N2OS/c1-5-12(13(16)19)17-14(18)10-6-8-11(9-7-10)15(2,3)4/h10-12H,5-9H2,1-4H3,(H2,16,19)(H,17,18) |
| InChIKey | FKLJSQCTAKBUNS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|