C16H30N2OS — CID 62718713
N-(1-amino-2-methyl-1-sulfanylidenebutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide (PubChem CID 62718713) has the molecular formula C16H30N2OS and a molecular weight of 298.50 g/mol. Its IUPAC name is N-(1-amino-2-methyl-1-sulfanylidenebutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide.
| Compound Name | N-(1-amino-2-methyl-1-sulfanylidenebutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 62718713 |
| Molecular Formula | C16H30N2OS |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | N-(1-amino-2-methyl-1-sulfanylidenebutan-2-yl)-4-tert-butylcyclohexane-1-carboxamide |
| SMILES | CCC(C)(NC(=O)C1CCC(C(C)(C)C)CC1)C(N)=S |
| InChI | InChI=1S/C16H30N2OS/c1-6-16(5,14(17)20)18-13(19)11-7-9-12(10-8-11)15(2,3)4/h11-12H,6-10H2,1-5H3,(H2,17,20)(H,18,19) |
| InChIKey | CDYGRPILAMCGMO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|