C22H40N2O2 — CID 123758150
N-[1-(2-aminocyclooctyl)-2-methyl-1-oxobutan-2-yl]cyclooctanecarboxamide (PubChem CID 123758150) has the molecular formula C22H40N2O2 and a molecular weight of 364.57 g/mol. Its IUPAC name is N-[1-(2-aminocyclooctyl)-2-methyl-1-oxobutan-2-yl]cyclooctanecarboxamide.
| Compound Name | N-[1-(2-aminocyclooctyl)-2-methyl-1-oxobutan-2-yl]cyclooctanecarboxamide |
|---|---|
| PubChem CID | 123758150 |
| Molecular Formula | C22H40N2O2 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | N-[1-(2-aminocyclooctyl)-2-methyl-1-oxobutan-2-yl]cyclooctanecarboxamide |
| SMILES | CCC(C)(NC(=O)C1CCCCCCC1)C(=O)C1CCCCCCC1N |
| InChI | InChI=1S/C22H40N2O2/c1-3-22(2,20(25)18-15-11-7-8-12-16-19(18)23)24-21(26)17-13-9-5-4-6-10-14-17/h17-19H,3-16,23H2,1-2H3,(H,24,26) |
| InChIKey | YULNEPITXUDCEU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |