C9H9F6NO — CID 106227765
3,3,3-trifluoro-N-pent-1-yn-3-yl-2-(trifluoromethyl)propanamide (PubChem CID 106227765) has the molecular formula C9H9F6NO and a molecular weight of 261.17 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-pent-1-yn-3-yl-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-pent-1-yn-3-yl-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 106227765 |
| Molecular Formula | C9H9F6NO |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3,3,3-trifluoro-N-pent-1-yn-3-yl-2-(trifluoromethyl)propanamide |
| SMILES | C#CC(CC)NC(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H9F6NO/c1-3-5(4-2)16-7(17)6(8(10,11)12)9(13,14)15/h1,5-6H,4H2,2H3,(H,16,17) |
| InChIKey | OQFRMZBVFXOESX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|