C9H12F7NO — CID 102171914
N-[(4S)-1,1,1,2,2,3,3-heptafluoroheptan-4-yl]acetamide (PubChem CID 102171914) has the molecular formula C9H12F7NO and a molecular weight of 283.19 g/mol. Its IUPAC name is N-[(4S)-1,1,1,2,2,3,3-heptafluoroheptan-4-yl]acetamide.
| Compound Name | N-[(4S)-1,1,1,2,2,3,3-heptafluoroheptan-4-yl]acetamide |
|---|---|
| PubChem CID | 102171914 |
| Molecular Formula | C9H12F7NO |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-[(4S)-1,1,1,2,2,3,3-heptafluoroheptan-4-yl]acetamide |
| SMILES | CCC[C@H](NC(C)=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F7NO/c1-3-4-6(17-5(2)18)7(10,11)8(12,13)9(14,15)16/h6H,3-4H2,1-2H3,(H,17,18)/t6-/m0/s1 |
| InChIKey | XZUGHBAHTLVVRE-LURJTMIESA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|