C16H35NO — CID 145106472
N-(2,2-dimethyl-4-propylheptan-3-yl)acetamide;ethane (PubChem CID 145106472) has the molecular formula C16H35NO and a molecular weight of 257.46 g/mol. Its IUPAC name is N-(2,2-dimethyl-4-propylheptan-3-yl)acetamide;ethane.
| Compound Name | N-(2,2-dimethyl-4-propylheptan-3-yl)acetamide;ethane |
|---|---|
| PubChem CID | 145106472 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | N-(2,2-dimethyl-4-propylheptan-3-yl)acetamide;ethane |
| SMILES | CC.CCCC(CCC)C(NC(C)=O)C(C)(C)C |
| InChI | InChI=1S/C14H29NO.C2H6/c1-7-9-12(10-8-2)13(14(4,5)6)15-11(3)16;1-2/h12-13H,7-10H2,1-6H3,(H,15,16);1-2H3 |
| InChIKey | FYZUYMYDUVLIRU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |