C9H20F3NO2 — CID 157037411
ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide (PubChem CID 157037411) has the molecular formula C9H20F3NO2 and a molecular weight of 231.26 g/mol. Its IUPAC name is ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide.
| Compound Name | ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 157037411 |
| Molecular Formula | C9H20F3NO2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide |
| SMILES | CC.CC.CC(=O)NC(CO)C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO2.2C2H6/c1-3(11)9-4(2-10)5(6,7)8;2*1-2/h4,10H,2H2,1H3,(H,9,11);2*1-2H3 |
| InChIKey | MNLZFEWGFFYZAV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |