About ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide
ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide (PubChem CID 157037411) has the molecular formula C9H20F3NO2
and a molecular weight of 231.26 g/mol. Its IUPAC name is ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide.
Molecular Properties
| Compound Name | ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide |
| PubChem CID | 157037411 |
| Molecular Formula | C9H20F3NO2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide |
| SMILES | CC.CC.CC(=O)NC(CO)C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO2.2C2H6/c1-3(11)9-4(2-10)5(6,7)8;2*1-2/h4,10H,2H2,1H3,(H,9,11);2*1-2H3 |
| InChIKey | MNLZFEWGFFYZAV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide?
The IUPAC name of ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide (CID 157037411) is ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide.
What is the SMILES notation for ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide?
The canonical SMILES for ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide is CC.CC.CC(=O)NC(CO)C(F)(F)F.
What is the InChIKey of ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide?
The InChIKey is MNLZFEWGFFYZAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F3NO2.2C2H6/c1-3(11)9-4(2-10)5(6,7)8;2*1-2/h4,10H,2H2,1H3,(H,9,11);2*1-2H3.
What are the key properties of ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide?
ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide has a molecular weight of 231.26 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(1,1,1-trifluoro-3-hydroxypropan-2-yl)acetamide is sourced from PubChem (CID 157037411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).