C11H16F3NO4S2 — CID 87529284
5-acetamido-3-ethoxycarbothioylsulfanyl-6,6,6-trifluorohexanoic acid (PubChem CID 87529284) has the molecular formula C11H16F3NO4S2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 5-acetamido-3-ethoxycarbothioylsulfanyl-6,6,6-trifluorohexanoic acid.
| Compound Name | 5-acetamido-3-ethoxycarbothioylsulfanyl-6,6,6-trifluorohexanoic acid |
|---|---|
| PubChem CID | 87529284 |
| Molecular Formula | C11H16F3NO4S2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 5-acetamido-3-ethoxycarbothioylsulfanyl-6,6,6-trifluorohexanoic acid |
| SMILES | CCOC(=S)SC(CC(=O)O)CC(NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO4S2/c1-3-19-10(20)21-7(5-9(17)18)4-8(11(12,13)14)15-6(2)16/h7-8H,3-5H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | LBNVFDCOBGJEJW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|