C10H17F3NO5PS2 — CID 87529316
(4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentyl)phosphonic acid (PubChem CID 87529316) has the molecular formula C10H17F3NO5PS2 and a molecular weight of 383.35 g/mol. Its IUPAC name is (4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentyl)phosphonic acid.
| Compound Name | (4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentyl)phosphonic acid |
|---|---|
| PubChem CID | 87529316 |
| Molecular Formula | C10H17F3NO5PS2 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | (4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentyl)phosphonic acid |
| SMILES | CCOC(=S)SC(CC(NC(C)=O)C(F)(F)F)CP(=O)(O)O |
| InChI | InChI=1S/C10H17F3NO5PS2/c1-3-19-9(21)22-7(5-20(16,17)18)4-8(10(11,12)13)14-6(2)15/h7-8H,3-5H2,1-2H3,(H,14,15)(H2,16,17,18) |
| InChIKey | UBYULXYDUULNKJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|