C9H14ClF4O3PS2 — CID 142872876
O-ethyl [4-chloro-5,5,5-trifluoro-1-[fluoro(methoxy)phosphoryl]pentan-2-yl]sulfanylmethanethioate (PubChem CID 142872876) has the molecular formula C9H14ClF4O3PS2 and a molecular weight of 376.76 g/mol. Its IUPAC name is O-ethyl [4-chloro-5,5,5-trifluoro-1-[fluoro(methoxy)phosphoryl]pentan-2-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [4-chloro-5,5,5-trifluoro-1-[fluoro(methoxy)phosphoryl]pentan-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 142872876 |
| Molecular Formula | C9H14ClF4O3PS2 |
| Molecular Weight | 376.76 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | O-ethyl [4-chloro-5,5,5-trifluoro-1-[fluoro(methoxy)phosphoryl]pentan-2-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CC(Cl)C(F)(F)F)CP(=O)(F)OC |
| InChI | InChI=1S/C9H14ClF4O3PS2/c1-3-17-8(19)20-6(5-18(14,15)16-2)4-7(10)9(11,12)13/h6-7H,3-5H2,1-2H3 |
| InChIKey | BCMYBHWGKTXQHS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.76 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|