C13H21NO7S2 — CID 10361610
methyl 5-acetyloxy-4-ethoxycarbothioylsulfanyl-2-(methoxycarbonylamino)pentanoate (PubChem CID 10361610) has the molecular formula C13H21NO7S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl 5-acetyloxy-4-ethoxycarbothioylsulfanyl-2-(methoxycarbonylamino)pentanoate.
| Compound Name | methyl 5-acetyloxy-4-ethoxycarbothioylsulfanyl-2-(methoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 10361610 |
| Molecular Formula | C13H21NO7S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | methyl 5-acetyloxy-4-ethoxycarbothioylsulfanyl-2-(methoxycarbonylamino)pentanoate |
| SMILES | CCOC(=S)SC(COC(C)=O)CC(NC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H21NO7S2/c1-5-20-13(22)23-9(7-21-8(2)15)6-10(11(16)18-3)14-12(17)19-4/h9-10H,5-7H2,1-4H3,(H,14,17) |
| InChIKey | OGHNPXZZJZAREL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|