C20H30F6N2O7PS4+ — CID 87529317
bis(4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentoxy)-oxophosphanium (PubChem CID 87529317) has the molecular formula C20H30F6N2O7PS4+ and a molecular weight of 683.70 g/mol. Its IUPAC name is bis(4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentoxy)-oxophosphanium.
| Compound Name | bis(4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentoxy)-oxophosphanium |
|---|---|
| PubChem CID | 87529317 |
| Molecular Formula | C20H30F6N2O7PS4+ |
| Molecular Weight | 683.70 g/mol |
| Exact Mass | 683.06 |
| IUPAC Name | bis(4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentoxy)-oxophosphanium |
| SMILES | CCOC(=S)SC(CO[P+](=O)OCC(CC(NC(C)=O)C(F)(F)F)SC(=S)OCC)CC(NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C20H29F6N2O7PS4/c1-5-32-17(37)39-13(7-15(19(21,22)23)27-11(3)29)9-34-36(31)35-10-14(40-18(38)33-6-2)8-16(20(24,25)26)28-12(4)30/h13-16H,5-10H2,1-4H3,(H-,27,28,29,30)/p+1 |
| InChIKey | JVGIQOBBMKTWEY-UHFFFAOYSA-O |
| XLogP | 5.44 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|