C16H28F3NO5S2 — CID 89021690
O-ethyl [1-ethoxy-6,6,6-trifluoro-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-3-yl]sulfanylmethanethioate (PubChem CID 89021690) has the molecular formula C16H28F3NO5S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is O-ethyl [1-ethoxy-6,6,6-trifluoro-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-3-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [1-ethoxy-6,6,6-trifluoro-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-3-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 89021690 |
| Molecular Formula | C16H28F3NO5S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | O-ethyl [1-ethoxy-6,6,6-trifluoro-1-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-3-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CC(O)OCC)CC(NC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H28F3NO5S2/c1-6-23-12(21)9-10(27-14(26)24-7-2)8-11(16(17,18)19)20-13(22)25-15(3,4)5/h10-12,21H,6-9H2,1-5H3,(H,20,22) |
| InChIKey | FNZNZXLQSVPETH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|