C13H22F3NO4S2 — CID 158359942
(4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentyl) acetate;methane (PubChem CID 158359942) has the molecular formula C13H22F3NO4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is (4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentyl) acetate;methane.
| Compound Name | (4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentyl) acetate;methane |
|---|---|
| PubChem CID | 158359942 |
| Molecular Formula | C13H22F3NO4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (4-acetamido-2-ethoxycarbothioylsulfanyl-5,5,5-trifluoropentyl) acetate;methane |
| SMILES | C.CCOC(=S)SC(COC(C)=O)CC(NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C12H18F3NO4S2.CH4/c1-4-19-11(21)22-9(6-20-8(3)18)5-10(12(13,14)15)16-7(2)17;/h9-10H,4-6H2,1-3H3,(H,16,17);1H4 |
| InChIKey | GTIQRXALFVDEPQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|