C8H13F3O3S2 — CID 159439200
(1-ethoxycarbothioylsulfanyl-2,2,2-trifluoroethyl) acetate;methane (PubChem CID 159439200) has the molecular formula C8H13F3O3S2 and a molecular weight of 278.32 g/mol. Its IUPAC name is (1-ethoxycarbothioylsulfanyl-2,2,2-trifluoroethyl) acetate;methane.
| Compound Name | (1-ethoxycarbothioylsulfanyl-2,2,2-trifluoroethyl) acetate;methane |
|---|---|
| PubChem CID | 159439200 |
| Molecular Formula | C8H13F3O3S2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (1-ethoxycarbothioylsulfanyl-2,2,2-trifluoroethyl) acetate;methane |
| SMILES | C.CCOC(=S)SC(OC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3O3S2.CH4/c1-3-12-6(14)15-5(7(8,9)10)13-4(2)11;/h5H,3H2,1-2H3;1H4 |
| InChIKey | LRYNRYLCSHNBJO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|