C6H7F3O3S2 — CID 58657868
(2,2,2-trifluoro-1-methoxycarbothioylsulfanylethyl) acetate (PubChem CID 58657868) has the molecular formula C6H7F3O3S2 and a molecular weight of 248.25 g/mol. Its IUPAC name is (2,2,2-trifluoro-1-methoxycarbothioylsulfanylethyl) acetate.
| Compound Name | (2,2,2-trifluoro-1-methoxycarbothioylsulfanylethyl) acetate |
|---|---|
| PubChem CID | 58657868 |
| Molecular Formula | C6H7F3O3S2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | (2,2,2-trifluoro-1-methoxycarbothioylsulfanylethyl) acetate |
| SMILES | COC(=S)SC(OC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C6H7F3O3S2/c1-3(10)12-4(6(7,8)9)14-5(13)11-2/h4H,1-2H3 |
| InChIKey | NIZSUYWAZPTEMO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|