C23H38O7S4 — CID 102080609
[9-acetyloxy-2,8-bis(ethoxycarbothioylsulfanyl)-10,10-dimethyl-5-oxoundecyl] acetate (PubChem CID 102080609) has the molecular formula C23H38O7S4 and a molecular weight of 554.82 g/mol. Its IUPAC name is [9-acetyloxy-2,8-bis(ethoxycarbothioylsulfanyl)-10,10-dimethyl-5-oxoundecyl] acetate.
| Compound Name | [9-acetyloxy-2,8-bis(ethoxycarbothioylsulfanyl)-10,10-dimethyl-5-oxoundecyl] acetate |
|---|---|
| PubChem CID | 102080609 |
| Molecular Formula | C23H38O7S4 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | [9-acetyloxy-2,8-bis(ethoxycarbothioylsulfanyl)-10,10-dimethyl-5-oxoundecyl] acetate |
| SMILES | CCOC(=S)SC(CCC(=O)CCC(SC(=S)OCC)C(OC(C)=O)C(C)(C)C)COC(C)=O |
| InChI | InChI=1S/C23H38O7S4/c1-8-27-21(31)33-18(14-29-15(3)24)12-10-17(26)11-13-19(34-22(32)28-9-2)20(23(5,6)7)30-16(4)25/h18-20H,8-14H2,1-7H3 |
| InChIKey | AALJIFXFQWXSAB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|