C14H26O3S2 — CID 146370207
2,4,4-trimethylpentan-2-yl 2-ethoxycarbothioylsulfanylpropanoate (PubChem CID 146370207) has the molecular formula C14H26O3S2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-yl 2-ethoxycarbothioylsulfanylpropanoate.
| Compound Name | 2,4,4-trimethylpentan-2-yl 2-ethoxycarbothioylsulfanylpropanoate |
|---|---|
| PubChem CID | 146370207 |
| Molecular Formula | C14H26O3S2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2,4,4-trimethylpentan-2-yl 2-ethoxycarbothioylsulfanylpropanoate |
| SMILES | CCOC(=S)SC(C)C(=O)OC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H26O3S2/c1-8-16-12(18)19-10(2)11(15)17-14(6,7)9-13(3,4)5/h10H,8-9H2,1-7H3 |
| InChIKey | NDCHSPRGFXBFHH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|