C13H24O2S2 — CID 175622911
O-ethyl 3-(2,3-dimethylbutan-2-yloxy)but-3-en-2-ylsulfanylmethanethioate (PubChem CID 175622911) has the molecular formula C13H24O2S2 and a molecular weight of 276.47 g/mol. Its IUPAC name is O-ethyl 3-(2,3-dimethylbutan-2-yloxy)but-3-en-2-ylsulfanylmethanethioate.
| Compound Name | O-ethyl 3-(2,3-dimethylbutan-2-yloxy)but-3-en-2-ylsulfanylmethanethioate |
|---|---|
| PubChem CID | 175622911 |
| Molecular Formula | C13H24O2S2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | O-ethyl 3-(2,3-dimethylbutan-2-yloxy)but-3-en-2-ylsulfanylmethanethioate |
| SMILES | C=C(OC(C)(C)C(C)C)C(C)SC(=S)OCC |
| InChI | InChI=1S/C13H24O2S2/c1-8-14-12(16)17-11(5)10(4)15-13(6,7)9(2)3/h9,11H,4,8H2,1-3,5-7H3 |
| InChIKey | JPOURWXUSLCBSU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|