C14H27O+ — CID 123618523
2-ethoxy-5-ethyl-3,5-dimethyl-3-methylhept-1-ene (PubChem CID 123618523) has the molecular formula C14H27O+ and a molecular weight of 211.37 g/mol. Its IUPAC name is 2-ethoxy-5-ethyl-3,5-dimethyl-3-methylhept-1-ene.
| Compound Name | 2-ethoxy-5-ethyl-3,5-dimethyl-3-methylhept-1-ene |
|---|---|
| PubChem CID | 123618523 |
| Molecular Formula | C14H27O+ |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.21 |
| IUPAC Name | 2-ethoxy-5-ethyl-3,5-dimethyl-3-methylhept-1-ene |
| SMILES | C=C(OCC)C([CH2+])(C)CC(C)(CC)CC |
| InChI | InChI=1S/C14H27O/c1-8-14(7,9-2)11-13(5,6)12(4)15-10-3/h4-5,8-11H2,1-3,6-7H3/q+1 |
| InChIKey | DWHPRELHLMBYQA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|