C9H16BNO2 — CID 23599189
CID 23599189 (PubChem CID 23599189) has the molecular formula C9H16BNO2 and a molecular weight of 181.04 g/mol.
| Compound Name | CID 23599189 |
|---|---|
| PubChem CID | 23599189 |
| Molecular Formula | C9H16BNO2 |
| Molecular Weight | 181.04 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N(C)C(C)(C)C(=C)OCC |
| InChI | InChI=1S/C9H16BNO2/c1-6-13-7(2)9(3,4)11(5)8(10)12/h2,6H2,1,3-5H3 |
| InChIKey | SXPYKIPAEVXDGQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.04 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|