C9H16ClNOWY — CID 23637831
N-(chloromethyl)-3-ethoxy-N,2-dimethanidylbut-3-en-2-amine;tungsten(2+);yttrium (PubChem CID 23637831) has the molecular formula C9H16ClNOWY and a molecular weight of 462.43 g/mol. Its IUPAC name is N-(chloromethyl)-3-ethoxy-N,2-dimethanidylbut-3-en-2-amine;tungsten(2+);yttrium.
| Compound Name | N-(chloromethyl)-3-ethoxy-N,2-dimethanidylbut-3-en-2-amine;tungsten(2+);yttrium |
|---|---|
| PubChem CID | 23637831 |
| Molecular Formula | C9H16ClNOWY |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 461.95 |
| IUPAC Name | N-(chloromethyl)-3-ethoxy-N,2-dimethanidylbut-3-en-2-amine;tungsten(2+);yttrium |
| SMILES | C=C(OCC)C([CH2-])(C)N([CH2-])CCl.[W+2].[Y] |
| InChI | InChI=1S/C9H16ClNO.W.Y/c1-6-12-8(2)9(3,4)11(5)7-10;;/h2-3,5-7H2,1,4H3;;/q-2;+2; |
| InChIKey | NWVXWYDMFGSIBG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|