C11H21F3 — CID 137409312
4-ethyl-1,1,1-trifluoro-2,2,4-trimethylhexane (PubChem CID 137409312) has the molecular formula C11H21F3 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-ethyl-1,1,1-trifluoro-2,2,4-trimethylhexane.
| Compound Name | 4-ethyl-1,1,1-trifluoro-2,2,4-trimethylhexane |
|---|---|
| PubChem CID | 137409312 |
| Molecular Formula | C11H21F3 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 4-ethyl-1,1,1-trifluoro-2,2,4-trimethylhexane |
| SMILES | CCC(C)(CC)CC(C)(C)C(F)(F)F |
| InChI | InChI=1S/C11H21F3/c1-6-10(5,7-2)8-9(3,4)11(12,13)14/h6-8H2,1-5H3 |
| InChIKey | GJJOENOBZMWXRS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |