C15H29F3 — CID 143328448
4,6-diethyl-4-methyl-6-(trifluoromethyl)nonane (PubChem CID 143328448) has the molecular formula C15H29F3 and a molecular weight of 266.39 g/mol. Its IUPAC name is 4,6-diethyl-4-methyl-6-(trifluoromethyl)nonane.
| Compound Name | 4,6-diethyl-4-methyl-6-(trifluoromethyl)nonane |
|---|---|
| PubChem CID | 143328448 |
| Molecular Formula | C15H29F3 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 4,6-diethyl-4-methyl-6-(trifluoromethyl)nonane |
| SMILES | CCCC(C)(CC)CC(CC)(CCC)C(F)(F)F |
| InChI | InChI=1S/C15H29F3/c1-6-10-13(5,8-3)12-14(9-4,11-7-2)15(16,17)18/h6-12H2,1-5H3 |
| InChIKey | ZBHZQAZJQOPXQC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |