C18H31F7 — CID 162585423
4-tert-butyl-1,1,1,5-tetrafluoro-2,4,5,6,6-pentamethyl-2-(trifluoromethyl)octane (PubChem CID 162585423) has the molecular formula C18H31F7 and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-tert-butyl-1,1,1,5-tetrafluoro-2,4,5,6,6-pentamethyl-2-(trifluoromethyl)octane.
| Compound Name | 4-tert-butyl-1,1,1,5-tetrafluoro-2,4,5,6,6-pentamethyl-2-(trifluoromethyl)octane |
|---|---|
| PubChem CID | 162585423 |
| Molecular Formula | C18H31F7 |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 4-tert-butyl-1,1,1,5-tetrafluoro-2,4,5,6,6-pentamethyl-2-(trifluoromethyl)octane |
| SMILES | CCC(C)(C)C(C)(F)C(C)(CC(C)(C(F)(F)F)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C18H31F7/c1-10-13(5,6)16(9,19)14(7,12(2,3)4)11-15(8,17(20,21)22)18(23,24)25/h10-11H2,1-9H3 |
| InChIKey | ZABOWOZQWBPVJL-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |