C15H25F7 — CID 162585393
1,1,1,5-tetrafluoro-2,4,5,6-tetramethyl-4-propan-2-yl-2-(trifluoromethyl)heptane (PubChem CID 162585393) has the molecular formula C15H25F7 and a molecular weight of 338.35 g/mol. Its IUPAC name is 1,1,1,5-tetrafluoro-2,4,5,6-tetramethyl-4-propan-2-yl-2-(trifluoromethyl)heptane.
| Compound Name | 1,1,1,5-tetrafluoro-2,4,5,6-tetramethyl-4-propan-2-yl-2-(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 162585393 |
| Molecular Formula | C15H25F7 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1,1,1,5-tetrafluoro-2,4,5,6-tetramethyl-4-propan-2-yl-2-(trifluoromethyl)heptane |
| SMILES | CC(C)C(C)(F)C(C)(CC(C)(C(F)(F)F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C15H25F7/c1-9(2)11(5,13(7,16)10(3)4)8-12(6,14(17,18)19)15(20,21)22/h9-10H,8H2,1-7H3 |
| InChIKey | AMIQRQWSOYYBGA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |