C13H27F — CID 167184895
4-fluoro-2,3,4-trimethyl-3-propan-2-ylheptane (PubChem CID 167184895) has the molecular formula C13H27F and a molecular weight of 202.36 g/mol. Its IUPAC name is 4-fluoro-2,3,4-trimethyl-3-propan-2-ylheptane.
| Compound Name | 4-fluoro-2,3,4-trimethyl-3-propan-2-ylheptane |
|---|---|
| PubChem CID | 167184895 |
| Molecular Formula | C13H27F |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.21 |
| IUPAC Name | 4-fluoro-2,3,4-trimethyl-3-propan-2-ylheptane |
| SMILES | CCCC(C)(F)C(C)(C(C)C)C(C)C |
| InChI | InChI=1S/C13H27F/c1-8-9-12(6,14)13(7,10(2)3)11(4)5/h10-11H,8-9H2,1-7H3 |
| InChIKey | CJROEZLGJRKWJI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |