C13H27F — CID 170941312
(6S)-3-ethyl-6-fluoro-4,6-dimethylnonane (PubChem CID 170941312) has the molecular formula C13H27F and a molecular weight of 202.36 g/mol. Its IUPAC name is (6S)-3-ethyl-6-fluoro-4,6-dimethylnonane.
| Compound Name | (6S)-3-ethyl-6-fluoro-4,6-dimethylnonane |
|---|---|
| PubChem CID | 170941312 |
| Molecular Formula | C13H27F |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.21 |
| IUPAC Name | (6S)-3-ethyl-6-fluoro-4,6-dimethylnonane |
| SMILES | CCC[C@](C)(F)CC(C)C(CC)CC |
| InChI | InChI=1S/C13H27F/c1-6-9-13(5,14)10-11(4)12(7-2)8-3/h11-12H,6-10H2,1-5H3/t11?,13-/m0/s1 |
| InChIKey | BDDPBZFEKRFLKN-YUZLPWPTSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |