C11H24O — CID 59910933
(3S)-2,2-dimethyl-3-propan-2-ylhexan-3-ol (PubChem CID 59910933) has the molecular formula C11H24O and a molecular weight of 172.31 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-3-propan-2-ylhexan-3-ol.
| Compound Name | (3S)-2,2-dimethyl-3-propan-2-ylhexan-3-ol |
|---|---|
| PubChem CID | 59910933 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | (3S)-2,2-dimethyl-3-propan-2-ylhexan-3-ol |
| SMILES | CCC[C@](O)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24O/c1-7-8-11(12,9(2)3)10(4,5)6/h9,12H,7-8H2,1-6H3/t11-/m0/s1 |
| InChIKey | JWYRCMWHIPGFNG-NSHDSACASA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |