C10H22O — CID 170849873
(3R,4R)-2,2,3,4-tetramethylhexan-3-ol (PubChem CID 170849873) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is (3R,4R)-2,2,3,4-tetramethylhexan-3-ol.
| Compound Name | (3R,4R)-2,2,3,4-tetramethylhexan-3-ol |
|---|---|
| PubChem CID | 170849873 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | (3R,4R)-2,2,3,4-tetramethylhexan-3-ol |
| SMILES | CC[C@@H](C)[C@@](C)(O)C(C)(C)C |
| InChI | InChI=1S/C10H22O/c1-7-8(2)10(6,11)9(3,4)5/h8,11H,7H2,1-6H3/t8-,10-/m1/s1 |
| InChIKey | SAFMWGCEQYLRLS-PSASIEDQSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |