C21H44O2 — CID 175564965
4,6-di(butan-2-yl)-5-ethyl-3,7-dimethylnonane-4,6-diol (PubChem CID 175564965) has the molecular formula C21H44O2 and a molecular weight of 328.58 g/mol. Its IUPAC name is 4,6-di(butan-2-yl)-5-ethyl-3,7-dimethylnonane-4,6-diol.
| Compound Name | 4,6-di(butan-2-yl)-5-ethyl-3,7-dimethylnonane-4,6-diol |
|---|---|
| PubChem CID | 175564965 |
| Molecular Formula | C21H44O2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.33 |
| IUPAC Name | 4,6-di(butan-2-yl)-5-ethyl-3,7-dimethylnonane-4,6-diol |
| SMILES | CCC(C)C(O)(C(C)CC)C(CC)C(O)(C(C)CC)C(C)CC |
| InChI | InChI=1S/C21H44O2/c1-10-15(6)20(22,16(7)11-2)19(14-5)21(23,17(8)12-3)18(9)13-4/h15-19,22-23H,10-14H2,1-9H3 |
| InChIKey | HYMWDSZHZFCFKD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |